C28H35BrN2O3S — CID 69486377
4-(2-benzylsulfanylethyl)-7-bromo-N-cyclohexyl-3-oxo-2-propan-2-yl-5H-1,4-benzoxazepine-5-carboxamide (PubChem CID 69486377) has the molecular formula C28H35BrN2O3S and a molecular weight of 559.57 g/mol. Its IUPAC name is 4-(2-benzylsulfanylethyl)-7-bromo-N-cyclohexyl-3-oxo-2-propan-2-yl-5H-1,4-benzoxazepine-5-carboxamide.
| Compound Name | 4-(2-benzylsulfanylethyl)-7-bromo-N-cyclohexyl-3-oxo-2-propan-2-yl-5H-1,4-benzoxazepine-5-carboxamide |
|---|---|
| PubChem CID | 69486377 |
| Molecular Formula | C28H35BrN2O3S |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 4-(2-benzylsulfanylethyl)-7-bromo-N-cyclohexyl-3-oxo-2-propan-2-yl-5H-1,4-benzoxazepine-5-carboxamide |
| SMILES | CC(C)C1Oc2ccc(Br)cc2C(C(=O)NC2CCCCC2)N(CCSCc2ccccc2)C1=O |
| InChI | InChI=1S/C28H35BrN2O3S/c1-19(2)26-28(33)31(15-16-35-18-20-9-5-3-6-10-20)25(23-17-21(29)13-14-24(23)34-26)27(32)30-22-11-7-4-8-12-22/h3,5-6,9-10,13-14,17,19,22,25-26H,4,7-8,11-12,15-16,18H2,1-2H3,(H,30,32) |
| InChIKey | OVLGNLHKMOOPDT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|