C12H21N3O3 — CID 69486464
8-[(3S,4S)-4-hydroxyoxan-3-yl]-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 69486464) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 8-[(3S,4S)-4-hydroxyoxan-3-yl]-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[(3S,4S)-4-hydroxyoxan-3-yl]-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 69486464 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 8-[(3S,4S)-4-hydroxyoxan-3-yl]-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C1NCNC12CCN([C@H]1COCC[C@@H]1O)CC2 |
| InChI | InChI=1S/C12H21N3O3/c16-10-1-6-18-7-9(10)15-4-2-12(3-5-15)11(17)13-8-14-12/h9-10,14,16H,1-8H2,(H,13,17)/t9-,10-/m0/s1 |
| InChIKey | PUJKSPLEVHWLAP-UWVGGRQHSA-N |
| XLogP | -1.35 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |