About methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid
methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid (PubChem CID 69487568) has the molecular formula C23H22N4O4
and a molecular weight of 418.45 g/mol. Its IUPAC name is methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid.
Molecular Properties
| Compound Name | methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid |
| PubChem CID | 69487568 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid |
| SMILES | COC(=O)c1cnc(-c2ccccc2)n1C.Cn1cc(C(=O)O)nc1-c1ccccc1 |
| InChI | InChI=1S/C12H12N2O2.C11H10N2O2/c1-14-10(12(15)16-2)8-13-11(14)9-6-4-3-5-7-9;1-13-7-9(11(14)15)12-10(13)8-5-3-2-4-6-8/h3-8H,1-2H3;2-7H,1H3,(H,14,15) |
| InChIKey | JJGFHHFWBZTBIL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid?
The IUPAC name of methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid (CID 69487568) is methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid.
What is the SMILES notation for methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid?
The canonical SMILES for methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid is COC(=O)c1cnc(-c2ccccc2)n1C.Cn1cc(C(=O)O)nc1-c1ccccc1.
What is the InChIKey of methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid?
The InChIKey is JJGFHHFWBZTBIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2.C11H10N2O2/c1-14-10(12(15)16-2)8-13-11(14)9-6-4-3-5-7-9;1-13-7-9(11(14)15)12-10(13)8-5-3-2-4-6-8/h3-8H,1-2H3;2-7H,1H3,(H,14,15).
What are the key properties of methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid?
methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid has a molecular weight of 418.45 g/mol, XLogP of 3.66, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-2-phenylimidazole-4-carboxylate;1-methyl-2-phenylimidazole-4-carboxylic acid is sourced from PubChem (CID 69487568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).