About methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate
methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate (PubChem CID 69487617) has the molecular formula C23H33NO5
and a molecular weight of 403.52 g/mol. Its IUPAC name is methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate.
Molecular Properties
| Compound Name | methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate |
| PubChem CID | 69487617 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate |
| SMILES | CCOC(Cc1c(C)cc(OCc2nc(C(C)(C)C)oc2C)cc1C)C(=O)OC |
| InChI | InChI=1S/C23H33NO5/c1-9-27-20(21(25)26-8)12-18-14(2)10-17(11-15(18)3)28-13-19-16(4)29-22(24-19)23(5,6)7/h10-11,20H,9,12-13H2,1-8H3 |
| InChIKey | NHLFTGBQVBDNHC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate?
The IUPAC name of methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate (CID 69487617) is methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate.
What is the SMILES notation for methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate?
The canonical SMILES for methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate is CCOC(Cc1c(C)cc(OCc2nc(C(C)(C)C)oc2C)cc1C)C(=O)OC.
What is the InChIKey of methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate?
The InChIKey is NHLFTGBQVBDNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33NO5/c1-9-27-20(21(25)26-8)12-18-14(2)10-17(11-15(18)3)28-13-19-16(4)29-22(24-19)23(5,6)7/h10-11,20H,9,12-13H2,1-8H3.
What are the key properties of methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate?
methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate has a molecular weight of 403.52 g/mol, XLogP of 4.60, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methoxy]-2,6-dimethylphenyl]-2-ethoxypropanoate is sourced from PubChem (CID 69487617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).