About 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid
2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid (PubChem CID 694878) has the molecular formula C9H10N4O4
and a molecular weight of 238.20 g/mol. Its IUPAC name is 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid |
| PubChem CID | 694878 |
| Molecular Formula | C9H10N4O4 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid |
| SMILES | Cc1cn2c(C)nc([N+](=O)[O-])c2n1CC(=O)O |
| InChI | InChI=1S/C9H10N4O4/c1-5-3-12-6(2)10-8(13(16)17)9(12)11(5)4-7(14)15/h3H,4H2,1-2H3,(H,14,15) |
| InChIKey | HNKICNKIJBBRSP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid?
The IUPAC name of 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid (CID 694878) is 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid.
What is the SMILES notation for 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid?
The canonical SMILES for 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid is Cc1cn2c(C)nc([N+](=O)[O-])c2n1CC(=O)O.
What is the InChIKey of 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid?
The InChIKey is HNKICNKIJBBRSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O4/c1-5-3-12-6(2)10-8(13(16)17)9(12)11(5)4-7(14)15/h3H,4H2,1-2H3,(H,14,15).
What are the key properties of 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid?
2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid has a molecular weight of 238.20 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethyl-7-nitroimidazo[1,2-c]imidazol-1-yl)acetic acid is sourced from PubChem (CID 694878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).