C19H29NO3 — CID 69487923
tert-butyl (3R)-3-(1-benzylpyrrolidin-2-yl)-3-methoxypropanoate (PubChem CID 69487923) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is tert-butyl (3R)-3-(1-benzylpyrrolidin-2-yl)-3-methoxypropanoate.
| Compound Name | tert-butyl (3R)-3-(1-benzylpyrrolidin-2-yl)-3-methoxypropanoate |
|---|---|
| PubChem CID | 69487923 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | tert-butyl (3R)-3-(1-benzylpyrrolidin-2-yl)-3-methoxypropanoate |
| SMILES | CO[C@H](CC(=O)OC(C)(C)C)C1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C19H29NO3/c1-19(2,3)23-18(21)13-17(22-4)16-11-8-12-20(16)14-15-9-6-5-7-10-15/h5-7,9-10,16-17H,8,11-14H2,1-4H3/t16?,17-/m1/s1 |
| InChIKey | PALAOXZRJBQHEB-ZYMOGRSISA-N |
| XLogP | 3.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |