About pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate
pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 69487986) has the molecular formula C23H20N6O3
and a molecular weight of 428.45 g/mol. Its IUPAC name is pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate.
Molecular Properties
| Compound Name | pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate |
| PubChem CID | 69487986 |
| Molecular Formula | C23H20N6O3 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | Cc1cc(N)c2cc(NC(=O)c3ccc(CNC(=O)Oc4cnccn4)cc3)ccc2n1 |
| InChI | InChI=1S/C23H20N6O3/c1-14-10-19(24)18-11-17(6-7-20(18)28-14)29-22(30)16-4-2-15(3-5-16)12-27-23(31)32-21-13-25-8-9-26-21/h2-11,13H,12H2,1H3,(H2,24,28)(H,27,31)(H,29,30) |
| InChIKey | HKYNAJNRSUILOU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate?
The IUPAC name of pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate (CID 69487986) is pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate.
What is the SMILES notation for pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate?
The canonical SMILES for pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate is Cc1cc(N)c2cc(NC(=O)c3ccc(CNC(=O)Oc4cnccn4)cc3)ccc2n1.
What is the InChIKey of pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate?
The InChIKey is HKYNAJNRSUILOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N6O3/c1-14-10-19(24)18-11-17(6-7-20(18)28-14)29-22(30)16-4-2-15(3-5-16)12-27-23(31)32-21-13-25-8-9-26-21/h2-11,13H,12H2,1H3,(H2,24,28)(H,27,31)(H,29,30).
What are the key properties of pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate?
pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate has a molecular weight of 428.45 g/mol, XLogP of 3.46, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazin-2-yl N-[[4-[(4-amino-2-methylquinolin-6-yl)carbamoyl]phenyl]methyl]carbamate is sourced from PubChem (CID 69487986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).