About [4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate
[4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 69488055) has the molecular formula C9H14F3NO3
and a molecular weight of 241.21 g/mol. Its IUPAC name is [4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate.
Analyze [4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate?
The IUPAC name of [4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate (CID 69488055) is [4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate.
What is the SMILES notation for [4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate?
The canonical SMILES for [4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate is COCC1CCN(OC(=O)C(F)(F)F)CC1.
What is the InChIKey of [4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate?
The InChIKey is DIKWPTPYHVXKBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO3/c1-15-6-7-2-4-13(5-3-7)16-8(14)9(10,11)12/h7H,2-6H2,1H3.
What are the key properties of [4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate?
[4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate has a molecular weight of 241.21 g/mol, XLogP of 1.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methoxymethyl)piperidin-1-yl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 69488055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).