C32H30N4O8 — CID 69488098
2,5-bis[3-[(3-aminophenyl)methyl-methylcarbamoyl]oxyprop-1-ynyl]terephthalic acid (PubChem CID 69488098) has the molecular formula C32H30N4O8 and a molecular weight of 598.61 g/mol. Its IUPAC name is 2,5-bis[3-[(3-aminophenyl)methyl-methylcarbamoyl]oxyprop-1-ynyl]terephthalic acid.
| Compound Name | 2,5-bis[3-[(3-aminophenyl)methyl-methylcarbamoyl]oxyprop-1-ynyl]terephthalic acid |
|---|---|
| PubChem CID | 69488098 |
| Molecular Formula | C32H30N4O8 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 2,5-bis[3-[(3-aminophenyl)methyl-methylcarbamoyl]oxyprop-1-ynyl]terephthalic acid |
| SMILES | CN(Cc1cccc(N)c1)C(=O)OCC#Cc1cc(C(=O)O)c(C#CCOC(=O)N(C)Cc2cccc(N)c2)cc1C(=O)O |
| InChI | InChI=1S/C32H30N4O8/c1-35(19-21-7-3-11-25(33)15-21)31(41)43-13-5-9-23-17-28(30(39)40)24(18-27(23)29(37)38)10-6-14-44-32(42)36(2)20-22-8-4-12-26(34)16-22/h3-4,7-8,11-12,15-18H,13-14,19-20,33-34H2,1-2H3,(H,37,38)(H,39,40) |
| InChIKey | ZUUCQIOGGNMBFG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 185.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|