About 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide
3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide (PubChem CID 69488419) has the molecular formula C20H21N3O4
and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide.
Molecular Properties
| Compound Name | 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide |
| PubChem CID | 69488419 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide |
| SMILES | CN1C(=O)C(C)(C)c2cc(C(CC(N)=O)c3ccccc3)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H21N3O4/c1-20(2)15-9-14(13(10-18(21)24)12-7-5-4-6-8-12)16(23(26)27)11-17(15)22(3)19(20)25/h4-9,11,13H,10H2,1-3H3,(H2,21,24) |
| InChIKey | AMUWBVTYABHOFG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide?
The IUPAC name of 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide (CID 69488419) is 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide.
What is the SMILES notation for 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide?
The canonical SMILES for 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide is CN1C(=O)C(C)(C)c2cc(C(CC(N)=O)c3ccccc3)c([N+](=O)[O-])cc21.
What is the InChIKey of 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide?
The InChIKey is AMUWBVTYABHOFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O4/c1-20(2)15-9-14(13(10-18(21)24)12-7-5-4-6-8-12)16(23(26)27)11-17(15)22(3)19(20)25/h4-9,11,13H,10H2,1-3H3,(H2,21,24).
What are the key properties of 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide?
3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide has a molecular weight of 367.41 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-3-(1,3,3-trimethyl-6-nitro-2-oxoindol-5-yl)propanamide is sourced from PubChem (CID 69488419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).