About 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one
3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one (PubChem CID 69488772) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one.
Molecular Properties
| Compound Name | 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one |
| PubChem CID | 69488772 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one |
| SMILES | C/C=C/CCC1=NNC(=O)C1 |
| InChI | InChI=1S/C8H12N2O/c1-2-3-4-5-7-6-8(11)10-9-7/h2-3H,4-6H2,1H3,(H,10,11)/b3-2+ |
| InChIKey | KAAYOPFHNAIKAQ-NSCUHMNNSA-N |
| XLogP | 1.22 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one?
The IUPAC name of 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one (CID 69488772) is 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one.
What is the SMILES notation for 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one?
The canonical SMILES for 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one is C/C=C/CCC1=NNC(=O)C1.
What is the InChIKey of 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one?
The InChIKey is KAAYOPFHNAIKAQ-NSCUHMNNSA-N. The full InChI is InChI=1S/C8H12N2O/c1-2-3-4-5-7-6-8(11)10-9-7/h2-3H,4-6H2,1H3,(H,10,11)/b3-2+.
What are the key properties of 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one?
3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one has a molecular weight of 152.20 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-pent-3-enyl]-1,4-dihydropyrazol-5-one is sourced from PubChem (CID 69488772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).