About 1-hexyl-1,2-dimethylimidazol-1-ium
1-hexyl-1,2-dimethylimidazol-1-ium (PubChem CID 69488882) has the molecular formula C11H21N2+
and a molecular weight of 181.30 g/mol. Its IUPAC name is 1-hexyl-1,2-dimethylimidazol-1-ium.
Molecular Properties
| Compound Name | 1-hexyl-1,2-dimethylimidazol-1-ium |
| PubChem CID | 69488882 |
| Molecular Formula | C11H21N2+ |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.17 |
| IUPAC Name | 1-hexyl-1,2-dimethylimidazol-1-ium |
| SMILES | CCCCCC[N+]1(C)C=CN=C1C |
| InChI | InChI=1S/C11H21N2/c1-4-5-6-7-9-13(3)10-8-12-11(13)2/h8,10H,4-7,9H2,1-3H3/q+1 |
| InChIKey | SJQQNABHCQNLII-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-1,2-dimethylimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-1,2-dimethylimidazol-1-ium?
The IUPAC name of 1-hexyl-1,2-dimethylimidazol-1-ium (CID 69488882) is 1-hexyl-1,2-dimethylimidazol-1-ium.
What is the SMILES notation for 1-hexyl-1,2-dimethylimidazol-1-ium?
The canonical SMILES for 1-hexyl-1,2-dimethylimidazol-1-ium is CCCCCC[N+]1(C)C=CN=C1C.
What is the InChIKey of 1-hexyl-1,2-dimethylimidazol-1-ium?
The InChIKey is SJQQNABHCQNLII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N2/c1-4-5-6-7-9-13(3)10-8-12-11(13)2/h8,10H,4-7,9H2,1-3H3/q+1.
What are the key properties of 1-hexyl-1,2-dimethylimidazol-1-ium?
1-hexyl-1,2-dimethylimidazol-1-ium has a molecular weight of 181.30 g/mol, XLogP of 2.92, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-1,2-dimethylimidazol-1-ium is sourced from PubChem (CID 69488882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).