About 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one
2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one (PubChem CID 69489019) has the molecular formula C17H15NO6
and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one |
| PubChem CID | 69489019 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2c(OCc3ccccc3)cccc2OC1C(=O)C(O)O |
| InChI | InChI=1S/C17H15NO6/c19-14(17(21)22)15-16(20)18-13-11(7-4-8-12(13)24-15)23-9-10-5-2-1-3-6-10/h1-8,15,17,21-22H,9H2,(H,18,20) |
| InChIKey | XRLCZNWZLOPFMP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one?
The IUPAC name of 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one (CID 69489019) is 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one is O=C1Nc2c(OCc3ccccc3)cccc2OC1C(=O)C(O)O.
What is the InChIKey of 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one?
The InChIKey is XRLCZNWZLOPFMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO6/c19-14(17(21)22)15-16(20)18-13-11(7-4-8-12(13)24-15)23-9-10-5-2-1-3-6-10/h1-8,15,17,21-22H,9H2,(H,18,20).
What are the key properties of 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one?
2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one has a molecular weight of 329.31 g/mol, XLogP of 0.84, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dihydroxyacetyl)-5-phenylmethoxy-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 69489019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).