About 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile
4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 69489049) has the molecular formula C20H18BrN5
and a molecular weight of 408.30 g/mol. Its IUPAC name is 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile |
| PubChem CID | 69489049 |
| Molecular Formula | C20H18BrN5 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | Cc1ccc(Nc2ncc(Br)c(Nc3ccc(C#N)cc3)n2)c(C)c1C |
| InChI | InChI=1S/C20H18BrN5/c1-12-4-9-18(14(3)13(12)2)25-20-23-11-17(21)19(26-20)24-16-7-5-15(10-22)6-8-16/h4-9,11H,1-3H3,(H2,23,24,25,26) |
| InChIKey | OZDQBFVASILSEV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile?
The IUPAC name of 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile (CID 69489049) is 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile.
What is the SMILES notation for 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile?
The canonical SMILES for 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile is Cc1ccc(Nc2ncc(Br)c(Nc3ccc(C#N)cc3)n2)c(C)c1C.
What is the InChIKey of 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile?
The InChIKey is OZDQBFVASILSEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18BrN5/c1-12-4-9-18(14(3)13(12)2)25-20-23-11-17(21)19(26-20)24-16-7-5-15(10-22)6-8-16/h4-9,11H,1-3H3,(H2,23,24,25,26).
What are the key properties of 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile?
4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile has a molecular weight of 408.30 g/mol, XLogP of 5.52, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-bromo-2-(2,3,4-trimethylanilino)pyrimidin-4-yl]amino]benzonitrile is sourced from PubChem (CID 69489049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).