C27H47N3O5 — CID 69489086
4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-octadec-9-enyloxolan-2-yl]pyrimidin-2-one (PubChem CID 69489086) has the molecular formula C27H47N3O5 and a molecular weight of 493.69 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-octadec-9-enyloxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-octadec-9-enyloxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 69489086 |
| Molecular Formula | C27H47N3O5 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.35 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-octadec-9-enyloxolan-2-yl]pyrimidin-2-one |
| SMILES | CCCCCCCCC=CCCCCCCCC[C@@]1(n2ccc(N)nc2=O)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H47N3O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-27(25(33)24(32)22(21-31)35-27)30-20-18-23(28)29-26(30)34/h9-10,18,20,22,24-25,31-33H,2-8,11-17,19,21H2,1H3,(H2,28,29,34)/t22-,24-,25-,27-/m1/s1 |
| InChIKey | OZLRGZLBPJEOKD-LYPBTDJXSA-N |
| XLogP | 4.02 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|