C9H15N — CID 69489122
4-[(Z)-but-2-en-2-yl]-1,2,3,6-tetrahydropyridine (PubChem CID 69489122) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 4-[(Z)-but-2-en-2-yl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[(Z)-but-2-en-2-yl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 69489122 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 4-[(Z)-but-2-en-2-yl]-1,2,3,6-tetrahydropyridine |
| SMILES | C/C=C(/C)C1=CCNCC1 |
| InChI | InChI=1S/C9H15N/c1-3-8(2)9-4-6-10-7-5-9/h3-4,10H,5-7H2,1-2H3/b8-3- |
| InChIKey | AVUWVNHWDPOYAT-BAQGIRSFSA-N |
| XLogP | 1.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |