C22H20Cl2N4O2 — CID 69489641
(4aS,8aR)-4-(3-chloro-4-methoxyphenyl)-2-(1H-indazol-5-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride (PubChem CID 69489641) has the molecular formula C22H20Cl2N4O2 and a molecular weight of 443.33 g/mol. Its IUPAC name is (4aS,8aR)-4-(3-chloro-4-methoxyphenyl)-2-(1H-indazol-5-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride.
| Compound Name | (4aS,8aR)-4-(3-chloro-4-methoxyphenyl)-2-(1H-indazol-5-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 69489641 |
| Molecular Formula | C22H20Cl2N4O2 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (4aS,8aR)-4-(3-chloro-4-methoxyphenyl)-2-(1H-indazol-5-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride |
| SMILES | COc1ccc(C2=NN(c3ccc4[nH]ncc4c3)C(=O)[C@@H]3CC=CC[C@H]23)cc1Cl.Cl |
| InChI | InChI=1S/C22H19ClN4O2.ClH/c1-29-20-9-6-13(11-18(20)23)21-16-4-2-3-5-17(16)22(28)27(26-21)15-7-8-19-14(10-15)12-24-25-19;/h2-3,6-12,16-17H,4-5H2,1H3,(H,24,25);1H/t16-,17+;/m0./s1 |
| InChIKey | KIJQHBAOVUQRAC-MCJVGQIASA-N |
| XLogP | 4.98 |
| TPSA | 70.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|