C28H36Cl2N4S — CID 69489975
5-tert-butyl-2-[4-methyl-3-(2-phenylethyl)piperazin-1-yl]-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene;dihydrochloride (PubChem CID 69489975) has the molecular formula C28H36Cl2N4S and a molecular weight of 531.60 g/mol. Its IUPAC name is 5-tert-butyl-2-[4-methyl-3-(2-phenylethyl)piperazin-1-yl]-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene;dihydrochloride.
| Compound Name | 5-tert-butyl-2-[4-methyl-3-(2-phenylethyl)piperazin-1-yl]-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene;dihydrochloride |
|---|---|
| PubChem CID | 69489975 |
| Molecular Formula | C28H36Cl2N4S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 5-tert-butyl-2-[4-methyl-3-(2-phenylethyl)piperazin-1-yl]-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene;dihydrochloride |
| SMILES | CN1CCN(C2=c3ncccc3=CNc3sc(C(C)(C)C)cc32)CC1CCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C28H34N4S.2ClH/c1-28(2,3)24-17-23-26(25-21(11-8-14-29-25)18-30-27(23)33-24)32-16-15-31(4)22(19-32)13-12-20-9-6-5-7-10-20;;/h5-11,14,17-18,22,30H,12-13,15-16,19H2,1-4H3;2*1H |
| InChIKey | XUWKOZZFWSVQQN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |