C25H39NO3 — CID 69490477
2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)-3,3-bis(prop-2-enoxy)piperidine (PubChem CID 69490477) has the molecular formula C25H39NO3 and a molecular weight of 401.59 g/mol. Its IUPAC name is 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)-3,3-bis(prop-2-enoxy)piperidine.
| Compound Name | 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)-3,3-bis(prop-2-enoxy)piperidine |
|---|---|
| PubChem CID | 69490477 |
| Molecular Formula | C25H39NO3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)-3,3-bis(prop-2-enoxy)piperidine |
| SMILES | C=CCOC1(OCC=C)CCC(C)(C)N(OC(C)c2ccccc2)C1(CC)CC |
| InChI | InChI=1S/C25H39NO3/c1-8-19-27-25(28-20-9-2)18-17-23(6,7)26(24(25,10-3)11-4)29-21(5)22-15-13-12-14-16-22/h8-9,12-16,21H,1-2,10-11,17-20H2,3-7H3 |
| InChIKey | UNXNFXYXPZNOSH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|