C18H18N6 — CID 6949198
(1S,4S,4aS)-4-(1,3-dimethylpyrazol-4-yl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile (PubChem CID 6949198) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is (1S,4S,4aS)-4-(1,3-dimethylpyrazol-4-yl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile.
| Compound Name | (1S,4S,4aS)-4-(1,3-dimethylpyrazol-4-yl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 6949198 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (1S,4S,4aS)-4-(1,3-dimethylpyrazol-4-yl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)C2=CCCC[C@H]2[C@@H](c2cn(C)nc2C)C1(C#N)C#N |
| InChI | InChI=1S/C18H18N6/c1-11-15(8-24(2)23-11)16-13-6-4-3-5-12(13)14(7-19)17(22)18(16,9-20)10-21/h5,8,13-14,16,22H,3-4,6H2,1-2H3/b22-17+/t13-,14+,16+/m1/s1 |
| InChIKey | HYXZQDAKBICCHZ-GEKBCAAGSA-N |
| XLogP | 2.75 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|