C26H22F3IN2O3 — CID 69492242
ethyl 3-iodo-4-(4-propan-2-yloxyphenyl)-5-[5-(trifluoromethyl)-2-pyridinyl]-1H-indole-2-carboxylate (PubChem CID 69492242) has the molecular formula C26H22F3IN2O3 and a molecular weight of 594.37 g/mol. Its IUPAC name is ethyl 3-iodo-4-(4-propan-2-yloxyphenyl)-5-[5-(trifluoromethyl)-2-pyridinyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-iodo-4-(4-propan-2-yloxyphenyl)-5-[5-(trifluoromethyl)-2-pyridinyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 69492242 |
| Molecular Formula | C26H22F3IN2O3 |
| Molecular Weight | 594.37 g/mol |
| Exact Mass | 594.06 |
| IUPAC Name | ethyl 3-iodo-4-(4-propan-2-yloxyphenyl)-5-[5-(trifluoromethyl)-2-pyridinyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(-c3ccc(C(F)(F)F)cn3)c(-c3ccc(OC(C)C)cc3)c2c1I |
| InChI | InChI=1S/C26H22F3IN2O3/c1-4-34-25(33)24-23(30)22-20(32-24)12-10-18(19-11-7-16(13-31-19)26(27,28)29)21(22)15-5-8-17(9-6-15)35-14(2)3/h5-14,32H,4H2,1-3H3 |
| InChIKey | NSGGPYDHCXXYSY-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.37 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|