About 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine
1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine (PubChem CID 69492363) has the molecular formula C24H33NS
and a molecular weight of 367.60 g/mol. Its IUPAC name is 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine.
Molecular Properties
| Compound Name | 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine |
| PubChem CID | 69492363 |
| Molecular Formula | C24H33NS |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine |
| SMILES | CC(C)(C)CC(C)(C)c1ccc2c(c1C(C)(C)C)Nc1ccccc1S2 |
| InChI | InChI=1S/C24H33NS/c1-22(2,3)15-24(7,8)16-13-14-19-21(20(16)23(4,5)6)25-17-11-9-10-12-18(17)26-19/h9-14,25H,15H2,1-8H3 |
| InChIKey | IXOGAVRSLYUNFK-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.60 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine?
The IUPAC name of 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine (CID 69492363) is 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine.
What is the SMILES notation for 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine?
The canonical SMILES for 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine is CC(C)(C)CC(C)(C)c1ccc2c(c1C(C)(C)C)Nc1ccccc1S2.
What is the InChIKey of 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine?
The InChIKey is IXOGAVRSLYUNFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33NS/c1-22(2,3)15-24(7,8)16-13-14-19-21(20(16)23(4,5)6)25-17-11-9-10-12-18(17)26-19/h9-14,25H,15H2,1-8H3.
What are the key properties of 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine?
1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine has a molecular weight of 367.60 g/mol, XLogP of 7.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine is sourced from PubChem (CID 69492363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).