C21H29FO3 — CID 69492534
[(9R,10R,13S,14S)-16-fluoro-17-hydroxy-10,13-dimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 69492534) has the molecular formula C21H29FO3 and a molecular weight of 348.46 g/mol. Its IUPAC name is [(9R,10R,13S,14S)-16-fluoro-17-hydroxy-10,13-dimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(9R,10R,13S,14S)-16-fluoro-17-hydroxy-10,13-dimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 69492534 |
| Molecular Formula | C21H29FO3 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [(9R,10R,13S,14S)-16-fluoro-17-hydroxy-10,13-dimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1(O)C(F)C[C@H]2C3=CCC4CCC=C[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H29FO3/c1-13(23)25-21(24)18(22)12-17-15-8-7-14-6-4-5-10-19(14,2)16(15)9-11-20(17,21)3/h5,8,10,14,16-18,24H,4,6-7,9,11-12H2,1-3H3/t14?,16-,17+,18?,19+,20+,21?/m1/s1 |
| InChIKey | OJGDFFYPSQHQGZ-LAKDGUQUSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|