About (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole
(2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole (PubChem CID 69492930) has the molecular formula C19H21N
and a molecular weight of 263.38 g/mol. Its IUPAC name is (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole |
| PubChem CID | 69492930 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole |
| SMILES | CCC1=N[C@H](C)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21N/c1-3-18-19(14-15(2)20-18,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15H,3,14H2,1-2H3/t15-/m1/s1 |
| InChIKey | UPZKJIHNKKJIKX-OAHLLOKOSA-N |
| XLogP | 4.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole?
The IUPAC name of (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole (CID 69492930) is (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole.
What is the SMILES notation for (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole?
The canonical SMILES for (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole is CCC1=N[C@H](C)CC1(c1ccccc1)c1ccccc1.
What is the InChIKey of (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole?
The InChIKey is UPZKJIHNKKJIKX-OAHLLOKOSA-N. The full InChI is InChI=1S/C19H21N/c1-3-18-19(14-15(2)20-18,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15H,3,14H2,1-2H3/t15-/m1/s1.
What are the key properties of (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole?
(2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole has a molecular weight of 263.38 g/mol, XLogP of 4.62, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-ethyl-2-methyl-4,4-diphenyl-2,3-dihydropyrrole is sourced from PubChem (CID 69492930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).