About 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide
6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide (PubChem CID 69492948) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 69492948 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide |
| SMILES | CC1(c2ncco2)C=CC=CC1C(N)=O |
| InChI | InChI=1S/C11H12N2O2/c1-11(10-13-6-7-15-10)5-3-2-4-8(11)9(12)14/h2-8H,1H3,(H2,12,14) |
| InChIKey | MPBOAQRIOCYTCE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide (CID 69492948) is 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide is CC1(c2ncco2)C=CC=CC1C(N)=O.
What is the InChIKey of 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide?
The InChIKey is MPBOAQRIOCYTCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-11(10-13-6-7-15-10)5-3-2-4-8(11)9(12)14/h2-8H,1H3,(H2,12,14).
What are the key properties of 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide?
6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide has a molecular weight of 204.23 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-6-(1,3-oxazol-2-yl)cyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 69492948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).