About (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane
(5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane (PubChem CID 69493001) has the molecular formula C18H28N4O2
and a molecular weight of 332.45 g/mol. Its IUPAC name is (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane |
| PubChem CID | 69493001 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane |
| SMILES | COc1ccnc(N2CCC[C@]3(CCN(C4CCOCC4)C3)C2)n1 |
| InChI | InChI=1S/C18H28N4O2/c1-23-16-3-8-19-17(20-16)22-9-2-6-18(14-22)7-10-21(13-18)15-4-11-24-12-5-15/h3,8,15H,2,4-7,9-14H2,1H3/t18-/m1/s1 |
| InChIKey | CXNBZEUFHSOMJO-GOSISDBHSA-N |
| XLogP | 1.96 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane?
The IUPAC name of (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane (CID 69493001) is (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane.
What is the SMILES notation for (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane?
The canonical SMILES for (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane is COc1ccnc(N2CCC[C@]3(CCN(C4CCOCC4)C3)C2)n1.
What is the InChIKey of (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane?
The InChIKey is CXNBZEUFHSOMJO-GOSISDBHSA-N. The full InChI is InChI=1S/C18H28N4O2/c1-23-16-3-8-19-17(20-16)22-9-2-6-18(14-22)7-10-21(13-18)15-4-11-24-12-5-15/h3,8,15H,2,4-7,9-14H2,1H3/t18-/m1/s1.
What are the key properties of (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane?
(5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane has a molecular weight of 332.45 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-7-(4-methoxypyrimidin-2-yl)-2-(oxan-4-yl)-2,7-diazaspiro[4.5]decane is sourced from PubChem (CID 69493001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).