C19H29NO2 — CID 69493031
(9S,10R,13S,14R)-7-amino-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,1-diol (PubChem CID 69493031) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (9S,10R,13S,14R)-7-amino-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,1-diol.
| Compound Name | (9S,10R,13S,14R)-7-amino-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,1-diol |
|---|---|
| PubChem CID | 69493031 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (9S,10R,13S,14R)-7-amino-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,1-diol |
| SMILES | C[C@@]12CCC[C@H]1C1=C(N)C=C3CCCC(O)(O)[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H29NO2/c1-17-8-4-6-13(17)16-14(7-10-17)18(2)12(11-15(16)20)5-3-9-19(18,21)22/h11,13-14,21-22H,3-10,20H2,1-2H3/t13-,14-,17-,18-/m0/s1 |
| InChIKey | FQMXMHQGHNPJKM-USJZOSNVSA-N |
| XLogP | 3.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|