About 2-ethenylphenol;1H-pyrrole
2-ethenylphenol;1H-pyrrole (PubChem CID 69493248) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-ethenylphenol;1H-pyrrole.
Molecular Properties
| Compound Name | 2-ethenylphenol;1H-pyrrole |
| PubChem CID | 69493248 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-ethenylphenol;1H-pyrrole |
| SMILES | C=Cc1ccccc1O.c1cc[nH]c1 |
| InChI | InChI=1S/C8H8O.C4H5N/c1-2-7-5-3-4-6-8(7)9;1-2-4-5-3-1/h2-6,9H,1H2;1-5H |
| InChIKey | SAMLRGMCFUVGNI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenylphenol;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylphenol;1H-pyrrole?
The IUPAC name of 2-ethenylphenol;1H-pyrrole (CID 69493248) is 2-ethenylphenol;1H-pyrrole.
What is the SMILES notation for 2-ethenylphenol;1H-pyrrole?
The canonical SMILES for 2-ethenylphenol;1H-pyrrole is C=Cc1ccccc1O.c1cc[nH]c1.
What is the InChIKey of 2-ethenylphenol;1H-pyrrole?
The InChIKey is SAMLRGMCFUVGNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C4H5N/c1-2-7-5-3-4-6-8(7)9;1-2-4-5-3-1/h2-6,9H,1H2;1-5H.
What are the key properties of 2-ethenylphenol;1H-pyrrole?
2-ethenylphenol;1H-pyrrole has a molecular weight of 187.24 g/mol, XLogP of 3.05, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylphenol;1H-pyrrole is sourced from PubChem (CID 69493248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).