C12H18N5O3+ — CID 6949347
[(8aR)-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium-2-yl]-(1-methyl-4-nitropyrazol-3-yl)methanone (PubChem CID 6949347) has the molecular formula C12H18N5O3+ and a molecular weight of 280.31 g/mol. Its IUPAC name is [(8aR)-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium-2-yl]-(1-methyl-4-nitropyrazol-3-yl)methanone.
| Compound Name | [(8aR)-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium-2-yl]-(1-methyl-4-nitropyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 6949347 |
| Molecular Formula | C12H18N5O3+ |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [(8aR)-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium-2-yl]-(1-methyl-4-nitropyrazol-3-yl)methanone |
| SMILES | Cn1cc([N+](=O)[O-])c(C(=O)N2CC[NH+]3CCC[C@@H]3C2)n1 |
| InChI | InChI=1S/C12H17N5O3/c1-14-8-10(17(19)20)11(13-14)12(18)16-6-5-15-4-2-3-9(15)7-16/h8-9H,2-7H2,1H3/p+1/t9-/m1/s1 |
| InChIKey | SUUSJJYAZWOCJT-SECBINFHSA-O |
| XLogP | -1.17 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|