About 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol
2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol (PubChem CID 69493493) has the molecular formula C17H18N2OS
and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol |
| PubChem CID | 69493493 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol |
| SMILES | OCCc1cc2c(NCCc3ccccc3)ccnc2s1 |
| InChI | InChI=1S/C17H18N2OS/c20-11-8-14-12-15-16(7-10-19-17(15)21-14)18-9-6-13-4-2-1-3-5-13/h1-5,7,10,12,20H,6,8-9,11H2,(H,18,19) |
| InChIKey | FNBAZDBJPYTMGI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol?
The IUPAC name of 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol (CID 69493493) is 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol.
What is the SMILES notation for 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol?
The canonical SMILES for 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol is OCCc1cc2c(NCCc3ccccc3)ccnc2s1.
What is the InChIKey of 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol?
The InChIKey is FNBAZDBJPYTMGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2OS/c20-11-8-14-12-15-16(7-10-19-17(15)21-14)18-9-6-13-4-2-1-3-5-13/h1-5,7,10,12,20H,6,8-9,11H2,(H,18,19).
What are the key properties of 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol?
2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol has a molecular weight of 298.41 g/mol, XLogP of 3.49, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-phenylethylamino)thieno[2,3-b]pyridin-2-yl]ethanol is sourced from PubChem (CID 69493493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).