C11H15N — CID 69493702
1,3a,4,4a,5,6,8a,8b-octahydroindeno[1,2-c]pyrrole (PubChem CID 69493702) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 1,3a,4,4a,5,6,8a,8b-octahydroindeno[1,2-c]pyrrole.
| Compound Name | 1,3a,4,4a,5,6,8a,8b-octahydroindeno[1,2-c]pyrrole |
|---|---|
| PubChem CID | 69493702 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1,3a,4,4a,5,6,8a,8b-octahydroindeno[1,2-c]pyrrole |
| SMILES | C1=CC2C(CC1)CC1C=NCC12 |
| InChI | InChI=1S/C11H15N/c1-2-4-10-8(3-1)5-9-6-12-7-11(9)10/h2,4,6,8-11H,1,3,5,7H2 |
| InChIKey | GSIIZYFBZPGWJK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|