About 7-pentan-3-yl-2,5-dihydrooxepine
7-pentan-3-yl-2,5-dihydrooxepine (PubChem CID 69493726) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 7-pentan-3-yl-2,5-dihydrooxepine.
Molecular Properties
| Compound Name | 7-pentan-3-yl-2,5-dihydrooxepine |
| PubChem CID | 69493726 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 7-pentan-3-yl-2,5-dihydrooxepine |
| SMILES | CCC(CC)C1=CCC=CCO1 |
| InChI | InChI=1S/C11H18O/c1-3-10(4-2)11-8-6-5-7-9-12-11/h5,7-8,10H,3-4,6,9H2,1-2H3 |
| InChIKey | DIVHMXUGDQLIPO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-pentan-3-yl-2,5-dihydrooxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pentan-3-yl-2,5-dihydrooxepine?
The IUPAC name of 7-pentan-3-yl-2,5-dihydrooxepine (CID 69493726) is 7-pentan-3-yl-2,5-dihydrooxepine.
What is the SMILES notation for 7-pentan-3-yl-2,5-dihydrooxepine?
The canonical SMILES for 7-pentan-3-yl-2,5-dihydrooxepine is CCC(CC)C1=CCC=CCO1.
What is the InChIKey of 7-pentan-3-yl-2,5-dihydrooxepine?
The InChIKey is DIVHMXUGDQLIPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-3-10(4-2)11-8-6-5-7-9-12-11/h5,7-8,10H,3-4,6,9H2,1-2H3.
What are the key properties of 7-pentan-3-yl-2,5-dihydrooxepine?
7-pentan-3-yl-2,5-dihydrooxepine has a molecular weight of 166.26 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pentan-3-yl-2,5-dihydrooxepine is sourced from PubChem (CID 69493726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).