About 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole
1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole (PubChem CID 69493869) has the molecular formula C25H21ClN4
and a molecular weight of 412.92 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole.
Molecular Properties
| Compound Name | 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole |
| PubChem CID | 69493869 |
| Molecular Formula | C25H21ClN4 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole |
| SMILES | Clc1ccccc1C(c1ccccc1)(c1ccccc1)n1ccnc1.c1c[nH]cn1 |
| InChI | InChI=1S/C22H17ClN2.C3H4N2/c23-21-14-8-7-13-20(21)22(25-16-15-24-17-25,18-9-3-1-4-10-18)19-11-5-2-6-12-19;1-2-5-3-4-1/h1-17H;1-3H,(H,4,5) |
| InChIKey | MUZMTSMXSPACKO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole?
The IUPAC name of 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole (CID 69493869) is 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole.
What is the SMILES notation for 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole?
The canonical SMILES for 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole is Clc1ccccc1C(c1ccccc1)(c1ccccc1)n1ccnc1.c1c[nH]cn1.
What is the InChIKey of 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole?
The InChIKey is MUZMTSMXSPACKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17ClN2.C3H4N2/c23-21-14-8-7-13-20(21)22(25-16-15-24-17-25,18-9-3-1-4-10-18)19-11-5-2-6-12-19;1-2-5-3-4-1/h1-17H;1-3H,(H,4,5).
What are the key properties of 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole?
1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole has a molecular weight of 412.92 g/mol, XLogP of 5.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1H-imidazole is sourced from PubChem (CID 69493869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).