C22H24N2O4 — CID 69495425
methyl 6-(2,5-dioxo-3-phenyl-3,4-dihydro-1,4-benzodiazepin-1-yl)hexanoate (PubChem CID 69495425) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 6-(2,5-dioxo-3-phenyl-3,4-dihydro-1,4-benzodiazepin-1-yl)hexanoate.
| Compound Name | methyl 6-(2,5-dioxo-3-phenyl-3,4-dihydro-1,4-benzodiazepin-1-yl)hexanoate |
|---|---|
| PubChem CID | 69495425 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl 6-(2,5-dioxo-3-phenyl-3,4-dihydro-1,4-benzodiazepin-1-yl)hexanoate |
| SMILES | COC(=O)CCCCCN1C(=O)C(c2ccccc2)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O4/c1-28-19(25)14-6-3-9-15-24-18-13-8-7-12-17(18)21(26)23-20(22(24)27)16-10-4-2-5-11-16/h2,4-5,7-8,10-13,20H,3,6,9,14-15H2,1H3,(H,23,26) |
| InChIKey | ZWTKNLNRZQLGGL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|