About tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid
tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid (PubChem CID 69495952) has the molecular formula C18H26Cl2N2O2
and a molecular weight of 373.32 g/mol. Its IUPAC name is tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid.
Molecular Properties
| Compound Name | tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid |
| PubChem CID | 69495952 |
| Molecular Formula | C18H26Cl2N2O2 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid |
| SMILES | C=CCC(CNC)(CN(C(=O)O)C(C)(C)C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H26Cl2N2O2/c1-6-9-18(11-21-5,12-22(16(23)24)17(2,3)4)13-7-8-14(19)15(20)10-13/h6-8,10,21H,1,9,11-12H2,2-5H3,(H,23,24) |
| InChIKey | JPPIKEKNOYZXLP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid?
The IUPAC name of tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid (CID 69495952) is tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid.
What is the SMILES notation for tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid?
The canonical SMILES for tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid is C=CCC(CNC)(CN(C(=O)O)C(C)(C)C)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid?
The InChIKey is JPPIKEKNOYZXLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26Cl2N2O2/c1-6-9-18(11-21-5,12-22(16(23)24)17(2,3)4)13-7-8-14(19)15(20)10-13/h6-8,10,21H,1,9,11-12H2,2-5H3,(H,23,24).
What are the key properties of tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid?
tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid has a molecular weight of 373.32 g/mol, XLogP of 4.81, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[2-(3,4-dichlorophenyl)-2-(methylaminomethyl)pent-4-enyl]carbamic acid is sourced from PubChem (CID 69495952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).