C25H22F2N2O6 — CID 69496339
(2R)-2-[[6-[3-[3-(aminomethyl)phenyl]-5-[(E)-2-carboxyethenyl]phenoxy]-3,5-difluoro-2-pyridinyl]oxy]butanoic acid (PubChem CID 69496339) has the molecular formula C25H22F2N2O6 and a molecular weight of 484.46 g/mol. Its IUPAC name is (2R)-2-[[6-[3-[3-(aminomethyl)phenyl]-5-[(E)-2-carboxyethenyl]phenoxy]-3,5-difluoro-2-pyridinyl]oxy]butanoic acid.
| Compound Name | (2R)-2-[[6-[3-[3-(aminomethyl)phenyl]-5-[(E)-2-carboxyethenyl]phenoxy]-3,5-difluoro-2-pyridinyl]oxy]butanoic acid |
|---|---|
| PubChem CID | 69496339 |
| Molecular Formula | C25H22F2N2O6 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (2R)-2-[[6-[3-[3-(aminomethyl)phenyl]-5-[(E)-2-carboxyethenyl]phenoxy]-3,5-difluoro-2-pyridinyl]oxy]butanoic acid |
| SMILES | CC[C@@H](Oc1nc(Oc2cc(/C=C/C(=O)O)cc(-c3cccc(CN)c3)c2)c(F)cc1F)C(=O)O |
| InChI | InChI=1S/C25H22F2N2O6/c1-2-21(25(32)33)35-24-20(27)12-19(26)23(29-24)34-18-10-14(6-7-22(30)31)8-17(11-18)16-5-3-4-15(9-16)13-28/h3-12,21H,2,13,28H2,1H3,(H,30,31)(H,32,33)/b7-6+/t21-/m1/s1 |
| InChIKey | HVAHTTBXEGRLHE-IRUYWQDXSA-N |
| XLogP | 4.62 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|