C19H13F3N2O3 — CID 69496628
[3-[3-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]phenyl]methylcarbamic acid (PubChem CID 69496628) has the molecular formula C19H13F3N2O3 and a molecular weight of 374.32 g/mol. Its IUPAC name is [3-[3-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]phenyl]methylcarbamic acid.
| Compound Name | [3-[3-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 69496628 |
| Molecular Formula | C19H13F3N2O3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [3-[3-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]phenyl]methylcarbamic acid |
| SMILES | O=C(O)NCc1cccc(-c2cccc(Oc3nc(F)c(F)cc3F)c2)c1 |
| InChI | InChI=1S/C19H13F3N2O3/c20-15-9-16(21)18(24-17(15)22)27-14-6-2-5-13(8-14)12-4-1-3-11(7-12)10-23-19(25)26/h1-9,23H,10H2,(H,25,26) |
| InChIKey | UGSHVKPUGJKDSJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|