C31H31F2N3O5 — CID 69496639
2-[[6-[3-[3-(aminomethyl)phenyl]phenoxy]-4-[3-(dimethylamino)propoxy]-3,5-difluoro-2-pyridinyl]oxy]-4-methylbenzoic acid (PubChem CID 69496639) has the molecular formula C31H31F2N3O5 and a molecular weight of 563.60 g/mol. Its IUPAC name is 2-[[6-[3-[3-(aminomethyl)phenyl]phenoxy]-4-[3-(dimethylamino)propoxy]-3,5-difluoro-2-pyridinyl]oxy]-4-methylbenzoic acid.
| Compound Name | 2-[[6-[3-[3-(aminomethyl)phenyl]phenoxy]-4-[3-(dimethylamino)propoxy]-3,5-difluoro-2-pyridinyl]oxy]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 69496639 |
| Molecular Formula | C31H31F2N3O5 |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 2-[[6-[3-[3-(aminomethyl)phenyl]phenoxy]-4-[3-(dimethylamino)propoxy]-3,5-difluoro-2-pyridinyl]oxy]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(Oc2nc(Oc3cccc(-c4cccc(CN)c4)c3)c(F)c(OCCCN(C)C)c2F)c1 |
| InChI | InChI=1S/C31H31F2N3O5/c1-19-11-12-24(31(37)38)25(15-19)41-30-27(33)28(39-14-6-13-36(2)3)26(32)29(35-30)40-23-10-5-9-22(17-23)21-8-4-7-20(16-21)18-34/h4-5,7-12,15-17H,6,13-14,18,34H2,1-3H3,(H,37,38) |
| InChIKey | RMNNARMJJJBRCW-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 107.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|