C11H19NO — CID 69497240
1,3,4,5,6,7,8,9-octahydro-2-benzoxepin-8-ylmethanamine (PubChem CID 69497240) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1,3,4,5,6,7,8,9-octahydro-2-benzoxepin-8-ylmethanamine.
| Compound Name | 1,3,4,5,6,7,8,9-octahydro-2-benzoxepin-8-ylmethanamine |
|---|---|
| PubChem CID | 69497240 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1,3,4,5,6,7,8,9-octahydro-2-benzoxepin-8-ylmethanamine |
| SMILES | NCC1CCC2=C(COCCC2)C1 |
| InChI | InChI=1S/C11H19NO/c12-7-9-3-4-10-2-1-5-13-8-11(10)6-9/h9H,1-8,12H2 |
| InChIKey | XJYNTJRBOQZOKD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|