C14H14ClN5O2S2 — CID 69497639
2-[3-[(6-chloro-5H-imidazo[2,1-b][1,3]thiazol-6-yl)sulfonyl]pyrrolo[2,3-b]pyridin-1-yl]ethanamine (PubChem CID 69497639) has the molecular formula C14H14ClN5O2S2 and a molecular weight of 383.89 g/mol. Its IUPAC name is 2-[3-[(6-chloro-5H-imidazo[2,1-b][1,3]thiazol-6-yl)sulfonyl]pyrrolo[2,3-b]pyridin-1-yl]ethanamine.
| Compound Name | 2-[3-[(6-chloro-5H-imidazo[2,1-b][1,3]thiazol-6-yl)sulfonyl]pyrrolo[2,3-b]pyridin-1-yl]ethanamine |
|---|---|
| PubChem CID | 69497639 |
| Molecular Formula | C14H14ClN5O2S2 |
| Molecular Weight | 383.89 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 2-[3-[(6-chloro-5H-imidazo[2,1-b][1,3]thiazol-6-yl)sulfonyl]pyrrolo[2,3-b]pyridin-1-yl]ethanamine |
| SMILES | NCCn1cc(S(=O)(=O)C2(Cl)CN3C=CSC3=N2)c2cccnc21 |
| InChI | InChI=1S/C14H14ClN5O2S2/c15-14(9-20-6-7-23-13(20)18-14)24(21,22)11-8-19(5-3-16)12-10(11)2-1-4-17-12/h1-2,4,6-8H,3,5,9,16H2 |
| InChIKey | MSEYCGSXWRTKHH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.89 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|