About 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline
2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline (PubChem CID 69498247) has the molecular formula C16H22N2O3
and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline.
Molecular Properties
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline |
| PubChem CID | 69498247 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline |
| SMILES | NC(CO)(CO)CO.Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.C4H11NO3/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;5-4(1-6,2-7)3-8/h1-9H,13H2;6-8H,1-3,5H2 |
| InChIKey | HIJBUFOXXUWGGC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline?
The IUPAC name of 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline (CID 69498247) is 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline.
What is the SMILES notation for 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline?
The canonical SMILES for 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline is NC(CO)(CO)CO.Nc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline?
The InChIKey is HIJBUFOXXUWGGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C4H11NO3/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;5-4(1-6,2-7)3-8/h1-9H,13H2;6-8H,1-3,5H2.
What are the key properties of 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline?
2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline has a molecular weight of 290.36 g/mol, XLogP of 0.60, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-phenylaniline is sourced from PubChem (CID 69498247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).