C20H30O2 — CID 69498466
3,6-dibutyl-4-cyclohexylcyclohexa-3,5-diene-1,2-dione (PubChem CID 69498466) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 3,6-dibutyl-4-cyclohexylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3,6-dibutyl-4-cyclohexylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 69498466 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 3,6-dibutyl-4-cyclohexylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCC1=CC(C2CCCCC2)=C(CCCC)C(=O)C1=O |
| InChI | InChI=1S/C20H30O2/c1-3-5-10-16-14-18(15-11-8-7-9-12-15)17(13-6-4-2)20(22)19(16)21/h14-15H,3-13H2,1-2H3 |
| InChIKey | AZELOMMUSFDVIC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|