C16H24O3 — CID 69498790
4-ethoxy-3,6-bis(2-methylpropyl)cyclohexa-3,5-diene-1,2-dione (PubChem CID 69498790) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 4-ethoxy-3,6-bis(2-methylpropyl)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-ethoxy-3,6-bis(2-methylpropyl)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 69498790 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 4-ethoxy-3,6-bis(2-methylpropyl)cyclohexa-3,5-diene-1,2-dione |
| SMILES | CCOC1=C(CC(C)C)C(=O)C(=O)C(CC(C)C)=C1 |
| InChI | InChI=1S/C16H24O3/c1-6-19-14-9-12(7-10(2)3)15(17)16(18)13(14)8-11(4)5/h9-11H,6-8H2,1-5H3 |
| InChIKey | ZXKVLZDLYDPSNN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|