2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid

C6H7NO3 — CID 69499110

IUPAC2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid
SMILESO=C(O)CC1C=CC(=O)N1
InChIInChI=1S/C6H7NO3/c8-5-2-1-4(7-5)3-6(9)10/h1-2,4H,3H2,(H,7,8)(H,9,10)
InChIKeyFNBIVYYAMIBHGM-UHFFFAOYSA-N
MW141.13 g/mol
LogP-0.48
Rot. Bonds2

About 2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid

2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid (PubChem CID 69499110) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is 2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid.

Molecular Properties

Compound Name2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid
PubChem CID69499110
Molecular FormulaC6H7NO3
Molecular Weight141.13 g/mol
Exact Mass141.04
IUPAC Name2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid
SMILESO=C(O)CC1C=CC(=O)N1
InChIInChI=1S/C6H7NO3/c8-5-2-1-4(7-5)3-6(9)10/h1-2,4H,3H2,(H,7,8)(H,9,10)
InChIKeyFNBIVYYAMIBHGM-UHFFFAOYSA-N
XLogP-0.48
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.13
LogP ≤ 5-0.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid?
The IUPAC name of 2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid (CID 69499110) is 2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid.
What is the SMILES notation for 2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid?
The canonical SMILES for 2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid is O=C(O)CC1C=CC(=O)N1.
What is the InChIKey of 2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid?
The InChIKey is FNBIVYYAMIBHGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c8-5-2-1-4(7-5)3-6(9)10/h1-2,4H,3H2,(H,7,8)(H,9,10).
What are the key properties of 2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid?
2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid has a molecular weight of 141.13 g/mol, XLogP of -0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-oxo-1,2-dihydropyrrol-2-yl)acetic acid is sourced from PubChem (CID 69499110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).