About (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol
(3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol (PubChem CID 69499638) has the molecular formula C16H22FNO3
and a molecular weight of 295.35 g/mol. Its IUPAC name is (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol |
| PubChem CID | 69499638 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol |
| SMILES | CC1(C)OCC(C2[C@H](O)C(F)CN2Cc2ccccc2)O1 |
| InChI | InChI=1S/C16H22FNO3/c1-16(2)20-10-13(21-16)14-15(19)12(17)9-18(14)8-11-6-4-3-5-7-11/h3-7,12-15,19H,8-10H2,1-2H3/t12?,13?,14?,15-/m1/s1 |
| InChIKey | XJMHNIZXQFSUSO-MLGYPOCJSA-N |
| XLogP | 1.72 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol?
The IUPAC name of (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol (CID 69499638) is (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol.
What is the SMILES notation for (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol?
The canonical SMILES for (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol is CC1(C)OCC(C2[C@H](O)C(F)CN2Cc2ccccc2)O1.
What is the InChIKey of (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol?
The InChIKey is XJMHNIZXQFSUSO-MLGYPOCJSA-N. The full InChI is InChI=1S/C16H22FNO3/c1-16(2)20-10-13(21-16)14-15(19)12(17)9-18(14)8-11-6-4-3-5-7-11/h3-7,12-15,19H,8-10H2,1-2H3/t12?,13?,14?,15-/m1/s1.
What are the key properties of (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol?
(3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol has a molecular weight of 295.35 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-fluoropyrrolidin-3-ol is sourced from PubChem (CID 69499638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).