C14H17F4NO3 — CID 695042
2,2,3,3-tetrafluoropropyl (1R,6S)-6-(cyclopropylcarbamoyl)cyclohex-3-ene-1-carboxylate (PubChem CID 695042) has the molecular formula C14H17F4NO3 and a molecular weight of 323.29 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl (1R,6S)-6-(cyclopropylcarbamoyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | 2,2,3,3-tetrafluoropropyl (1R,6S)-6-(cyclopropylcarbamoyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 695042 |
| Molecular Formula | C14H17F4NO3 |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl (1R,6S)-6-(cyclopropylcarbamoyl)cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(NC1CC1)[C@H]1CC=CC[C@H]1C(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C14H17F4NO3/c15-13(16)14(17,18)7-22-12(21)10-4-2-1-3-9(10)11(20)19-8-5-6-8/h1-2,8-10,13H,3-7H2,(H,19,20)/t9-,10+/m0/s1 |
| InChIKey | YSAFKEYBEDCBKO-VHSXEESVSA-N |
| XLogP | 2.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|