About (2S)-2-methylbutanedioic acid
(2S)-2-methylbutanedioic acid (PubChem CID 6950476) has the molecular formula C5H8O4
and a molecular weight of 132.11 g/mol. Its IUPAC name is (2S)-2-methylbutanedioic acid.
Molecular Properties
| Compound Name | (2S)-2-methylbutanedioic acid |
| PubChem CID | 6950476 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (2S)-2-methylbutanedioic acid |
| SMILES | C[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H8O4/c1-3(5(8)9)2-4(6)7/h3H,2H2,1H3,(H,6,7)(H,8,9)/t3-/m0/s1 |
| InChIKey | WXUAQHNMJWJLTG-VKHMYHEASA-N |
| XLogP | 0.18 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-methylbutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methylbutanedioic acid?
The IUPAC name of (2S)-2-methylbutanedioic acid (CID 6950476) is (2S)-2-methylbutanedioic acid.
What is the SMILES notation for (2S)-2-methylbutanedioic acid?
The canonical SMILES for (2S)-2-methylbutanedioic acid is C[C@@H](CC(=O)O)C(=O)O.
What is the InChIKey of (2S)-2-methylbutanedioic acid?
The InChIKey is WXUAQHNMJWJLTG-VKHMYHEASA-N. The full InChI is InChI=1S/C5H8O4/c1-3(5(8)9)2-4(6)7/h3H,2H2,1H3,(H,6,7)(H,8,9)/t3-/m0/s1.
What are the key properties of (2S)-2-methylbutanedioic acid?
(2S)-2-methylbutanedioic acid has a molecular weight of 132.11 g/mol, XLogP of 0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methylbutanedioic acid is sourced from PubChem (CID 6950476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).