(2S)-2-methylbutanedioic acid

C5H8O4 — CID 6950476

IUPAC(2S)-2-methylbutanedioic acid
SMILESC[C@@H](CC(=O)O)C(=O)O
InChIInChI=1S/C5H8O4/c1-3(5(8)9)2-4(6)7/h3H,2H2,1H3,(H,6,7)(H,8,9)/t3-/m0/s1
InChIKeyWXUAQHNMJWJLTG-VKHMYHEASA-N
MW132.11 g/mol
LogP0.18
Rot. Bonds3

About (2S)-2-methylbutanedioic acid

(2S)-2-methylbutanedioic acid (PubChem CID 6950476) has the molecular formula C5H8O4 and a molecular weight of 132.11 g/mol. Its IUPAC name is (2S)-2-methylbutanedioic acid.

Molecular Properties

Compound Name(2S)-2-methylbutanedioic acid
PubChem CID6950476
Molecular FormulaC5H8O4
Molecular Weight132.11 g/mol
Exact Mass132.04
IUPAC Name(2S)-2-methylbutanedioic acid
SMILESC[C@@H](CC(=O)O)C(=O)O
InChIInChI=1S/C5H8O4/c1-3(5(8)9)2-4(6)7/h3H,2H2,1H3,(H,6,7)(H,8,9)/t3-/m0/s1
InChIKeyWXUAQHNMJWJLTG-VKHMYHEASA-N
XLogP0.18
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.11
LogP ≤ 50.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S)-2-methylbutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-methylbutanedioic acid?
The IUPAC name of (2S)-2-methylbutanedioic acid (CID 6950476) is (2S)-2-methylbutanedioic acid.
What is the SMILES notation for (2S)-2-methylbutanedioic acid?
The canonical SMILES for (2S)-2-methylbutanedioic acid is C[C@@H](CC(=O)O)C(=O)O.
What is the InChIKey of (2S)-2-methylbutanedioic acid?
The InChIKey is WXUAQHNMJWJLTG-VKHMYHEASA-N. The full InChI is InChI=1S/C5H8O4/c1-3(5(8)9)2-4(6)7/h3H,2H2,1H3,(H,6,7)(H,8,9)/t3-/m0/s1.
What are the key properties of (2S)-2-methylbutanedioic acid?
(2S)-2-methylbutanedioic acid has a molecular weight of 132.11 g/mol, XLogP of 0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methylbutanedioic acid is sourced from PubChem (CID 6950476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).