(2R)-2-methylbutanoic acid

C5H10O2 — CID 6950479

IUPAC(2R)-2-methylbutanoic acid
SMILESCC[C@@H](C)C(=O)O
InChIInChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/t4-/m1/s1
InChIKeyWLAMNBDJUVNPJU-SCSAIBSYSA-N
MW102.13 g/mol
LogP1.12
Rot. Bonds2

About (2R)-2-methylbutanoic acid

(2R)-2-methylbutanoic acid (PubChem CID 6950479) has the molecular formula C5H10O2 and a molecular weight of 102.13 g/mol. Its IUPAC name is (2R)-2-methylbutanoic acid.

Molecular Properties

Compound Name(2R)-2-methylbutanoic acid
PubChem CID6950479
Molecular FormulaC5H10O2
Molecular Weight102.13 g/mol
Exact Mass102.07
IUPAC Name(2R)-2-methylbutanoic acid
SMILESCC[C@@H](C)C(=O)O
InChIInChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/t4-/m1/s1
InChIKeyWLAMNBDJUVNPJU-SCSAIBSYSA-N
XLogP1.12
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500102.13
LogP ≤ 51.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (2R)-2-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-methylbutanoic acid?
The IUPAC name of (2R)-2-methylbutanoic acid (CID 6950479) is (2R)-2-methylbutanoic acid.
What is the SMILES notation for (2R)-2-methylbutanoic acid?
The canonical SMILES for (2R)-2-methylbutanoic acid is CC[C@@H](C)C(=O)O.
What is the InChIKey of (2R)-2-methylbutanoic acid?
The InChIKey is WLAMNBDJUVNPJU-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/t4-/m1/s1.
What are the key properties of (2R)-2-methylbutanoic acid?
(2R)-2-methylbutanoic acid has a molecular weight of 102.13 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methylbutanoic acid is sourced from PubChem (CID 6950479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).