About benzene-1,4-dithiolate
benzene-1,4-dithiolate (PubChem CID 6950840) has the molecular formula C6H4S2-2
and a molecular weight of 140.23 g/mol. Its IUPAC name is benzene-1,4-dithiolate.
Molecular Properties
| Compound Name | benzene-1,4-dithiolate |
| PubChem CID | 6950840 |
| Molecular Formula | C6H4S2-2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 139.98 |
| IUPAC Name | benzene-1,4-dithiolate |
| SMILES | [S-]c1ccc([S-])cc1 |
| InChI | InChI=1S/C6H6S2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H/p-2 |
| InChIKey | WYLQRHZSKIDFEP-UHFFFAOYSA-L |
| XLogP | 1.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-dithiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-dithiolate?
The IUPAC name of benzene-1,4-dithiolate (CID 6950840) is benzene-1,4-dithiolate.
What is the SMILES notation for benzene-1,4-dithiolate?
The canonical SMILES for benzene-1,4-dithiolate is [S-]c1ccc([S-])cc1.
What is the InChIKey of benzene-1,4-dithiolate?
The InChIKey is WYLQRHZSKIDFEP-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H6S2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H/p-2.
What are the key properties of benzene-1,4-dithiolate?
benzene-1,4-dithiolate has a molecular weight of 140.23 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-dithiolate is sourced from PubChem (CID 6950840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).