C12H14NO3S- — CID 6950963
(2R)-2-acetamido-3-benzylsulfanylpropanoate (PubChem CID 6950963) has the molecular formula C12H14NO3S- and a molecular weight of 252.31 g/mol. Its IUPAC name is (2R)-2-acetamido-3-benzylsulfanylpropanoate.
| Compound Name | (2R)-2-acetamido-3-benzylsulfanylpropanoate |
|---|---|
| PubChem CID | 6950963 |
| Molecular Formula | C12H14NO3S- |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (2R)-2-acetamido-3-benzylsulfanylpropanoate |
| SMILES | CC(=O)N[C@@H](CSCc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C12H15NO3S/c1-9(14)13-11(12(15)16)8-17-7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3,(H,13,14)(H,15,16)/p-1/t11-/m0/s1 |
| InChIKey | BJUXDERNWYKSIQ-NSHDSACASA-M |
| XLogP | 0.17 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |